C15H20N2O — CID 175615486
(2R,4S)-N-(4-cyclopropylphenyl)-4-methylpyrrolidine-2-carboxamide (PubChem CID 175615486) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (2R,4S)-N-(4-cyclopropylphenyl)-4-methylpyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-N-(4-cyclopropylphenyl)-4-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 175615486 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2R,4S)-N-(4-cyclopropylphenyl)-4-methylpyrrolidine-2-carboxamide |
| SMILES | C[C@@H]1CN[C@@H](C(=O)Nc2ccc(C3CC3)cc2)C1 |
| InChI | InChI=1S/C15H20N2O/c1-10-8-14(16-9-10)15(18)17-13-6-4-12(5-7-13)11-2-3-11/h4-7,10-11,14,16H,2-3,8-9H2,1H3,(H,17,18)/t10-,14+/m0/s1 |
| InChIKey | MOWDUBKTTIOSEM-IINYFYTJSA-N |
| XLogP | 2.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |