C27H34O2 — CID 20503085
1-[4-[4-(4-butylcyclohexyl)phenyl]phenyl]pentane-1,3-dione (PubChem CID 20503085) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 1-[4-[4-(4-butylcyclohexyl)phenyl]phenyl]pentane-1,3-dione.
| Compound Name | 1-[4-[4-(4-butylcyclohexyl)phenyl]phenyl]pentane-1,3-dione |
|---|---|
| PubChem CID | 20503085 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 1-[4-[4-(4-butylcyclohexyl)phenyl]phenyl]pentane-1,3-dione |
| SMILES | CCCCC1CCC(c2ccc(-c3ccc(C(=O)CC(=O)CC)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H34O2/c1-3-5-6-20-7-9-21(10-8-20)22-11-13-23(14-12-22)24-15-17-25(18-16-24)27(29)19-26(28)4-2/h11-18,20-21H,3-10,19H2,1-2H3 |
| InChIKey | RLXXDDFMTFZPKQ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|