C21H30O2 — CID 20503164
1-[4-(4-pentylcyclohexyl)phenyl]butane-1,3-dione (PubChem CID 20503164) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-[4-(4-pentylcyclohexyl)phenyl]butane-1,3-dione.
| Compound Name | 1-[4-(4-pentylcyclohexyl)phenyl]butane-1,3-dione |
|---|---|
| PubChem CID | 20503164 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1-[4-(4-pentylcyclohexyl)phenyl]butane-1,3-dione |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)CC(C)=O)cc2)CC1 |
| InChI | InChI=1S/C21H30O2/c1-3-4-5-6-17-7-9-18(10-8-17)19-11-13-20(14-12-19)21(23)15-16(2)22/h11-14,17-18H,3-10,15H2,1-2H3 |
| InChIKey | BZCHLJURBMNUKJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|