C27H31F3O2 — CID 20503066
4,4,4-trifluoro-1-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]butane-1,3-dione (PubChem CID 20503066) has the molecular formula C27H31F3O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-1-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]butane-1,3-dione |
|---|---|
| PubChem CID | 20503066 |
| Molecular Formula | C27H31F3O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 4,4,4-trifluoro-1-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]butane-1,3-dione |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(C(=O)CC(=O)C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H31F3O2/c1-2-3-4-5-19-6-8-20(9-7-19)21-10-12-22(13-11-21)23-14-16-24(17-15-23)25(31)18-26(32)27(28,29)30/h10-17,19-20H,2-9,18H2,1H3 |
| InChIKey | RHZBRTDQINKEQL-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|