C16H17F3O2 — CID 3753475
1-(4-cyclohexylphenyl)-4,4,4-trifluorobutane-1,3-dione (PubChem CID 3753475) has the molecular formula C16H17F3O2 and a molecular weight of 298.30 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-4,4,4-trifluorobutane-1,3-dione.
| Compound Name | 1-(4-cyclohexylphenyl)-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| PubChem CID | 3753475 |
| Molecular Formula | C16H17F3O2 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-(4-cyclohexylphenyl)-4,4,4-trifluorobutane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C16H17F3O2/c17-16(18,19)15(21)10-14(20)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h6-9,11H,1-5,10H2 |
| InChIKey | RDNMCZBUTGHVSM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|