C33H31NO6 — CID 142000325
methyl 8-methoxy-2-(4-methoxyphenyl)-2-(4-morpholin-4-ylphenyl)benzo[h]chromene-5-carboxylate (PubChem CID 142000325) has the molecular formula C33H31NO6 and a molecular weight of 537.61 g/mol. Its IUPAC name is methyl 8-methoxy-2-(4-methoxyphenyl)-2-(4-morpholin-4-ylphenyl)benzo[h]chromene-5-carboxylate.
| Compound Name | methyl 8-methoxy-2-(4-methoxyphenyl)-2-(4-morpholin-4-ylphenyl)benzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 142000325 |
| Molecular Formula | C33H31NO6 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | methyl 8-methoxy-2-(4-methoxyphenyl)-2-(4-morpholin-4-ylphenyl)benzo[h]chromene-5-carboxylate |
| SMILES | COC(=O)c1cc2cc(OC)ccc2c2c1C=CC(c1ccc(OC)cc1)(c1ccc(N3CCOCC3)cc1)O2 |
| InChI | InChI=1S/C33H31NO6/c1-36-26-10-6-24(7-11-26)33(23-4-8-25(9-5-23)34-16-18-39-19-17-34)15-14-29-30(32(35)38-3)21-22-20-27(37-2)12-13-28(22)31(29)40-33/h4-15,20-21H,16-19H2,1-3H3 |
| InChIKey | AWMIVQOLVZDCNV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|