C34H34N2O4 — CID 22624741
4-[4-[9-methoxy-2-(4-morpholin-4-ylphenyl)benzo[h]chromen-2-yl]phenyl]morpholine (PubChem CID 22624741) has the molecular formula C34H34N2O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is 4-[4-[9-methoxy-2-(4-morpholin-4-ylphenyl)benzo[h]chromen-2-yl]phenyl]morpholine.
| Compound Name | 4-[4-[9-methoxy-2-(4-morpholin-4-ylphenyl)benzo[h]chromen-2-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 22624741 |
| Molecular Formula | C34H34N2O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 4-[4-[9-methoxy-2-(4-morpholin-4-ylphenyl)benzo[h]chromen-2-yl]phenyl]morpholine |
| SMILES | COc1ccc2ccc3c(c2c1)OC(c1ccc(N2CCOCC2)cc1)(c1ccc(N2CCOCC2)cc1)C=C3 |
| InChI | InChI=1S/C34H34N2O4/c1-37-31-13-4-25-2-3-26-14-15-34(40-33(26)32(25)24-31,27-5-9-29(10-6-27)35-16-20-38-21-17-35)28-7-11-30(12-8-28)36-18-22-39-23-19-36/h2-15,24H,16-23H2,1H3 |
| InChIKey | CGNYSCIZLGXFAS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|