C32H29NO6 — CID 70233183
2,2-bis(4-methoxyphenyl)-9-morpholin-4-ylbenzo[h]chromene-5-carboxylic acid (PubChem CID 70233183) has the molecular formula C32H29NO6 and a molecular weight of 523.59 g/mol. Its IUPAC name is 2,2-bis(4-methoxyphenyl)-9-morpholin-4-ylbenzo[h]chromene-5-carboxylic acid.
| Compound Name | 2,2-bis(4-methoxyphenyl)-9-morpholin-4-ylbenzo[h]chromene-5-carboxylic acid |
|---|---|
| PubChem CID | 70233183 |
| Molecular Formula | C32H29NO6 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 2,2-bis(4-methoxyphenyl)-9-morpholin-4-ylbenzo[h]chromene-5-carboxylic acid |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)C=Cc3c(C(=O)O)cc4ccc(N5CCOCC5)cc4c3O2)cc1 |
| InChI | InChI=1S/C32H29NO6/c1-36-25-9-4-22(5-10-25)32(23-6-11-26(37-2)12-7-23)14-13-27-29(31(34)35)19-21-3-8-24(20-28(21)30(27)39-32)33-15-17-38-18-16-33/h3-14,19-20H,15-18H2,1-2H3,(H,34,35) |
| InChIKey | FNZKSFMQEDGIOF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |