C51H43N3O5 — CID 66995549
methyl 2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-phenyl-8-[(4-phenylphenyl)carbamoyl]benzo[h]chromene-5-carboxylate (PubChem CID 66995549) has the molecular formula C51H43N3O5 and a molecular weight of 777.92 g/mol. Its IUPAC name is methyl 2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-phenyl-8-[(4-phenylphenyl)carbamoyl]benzo[h]chromene-5-carboxylate.
| Compound Name | methyl 2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-phenyl-8-[(4-phenylphenyl)carbamoyl]benzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 66995549 |
| Molecular Formula | C51H43N3O5 |
| Molecular Weight | 777.92 g/mol |
| Exact Mass | 777.32 |
| IUPAC Name | methyl 2-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-phenyl-8-[(4-phenylphenyl)carbamoyl]benzo[h]chromene-5-carboxylate |
| SMILES | COC(=O)c1cc2cc(C(=O)Nc3ccc(-c4ccccc4)cc3)ccc2c2c1C=CC(c1ccccc1)(c1ccc(N3CCN(c4ccc(OC)cc4)CC3)cc1)O2 |
| InChI | InChI=1S/C51H43N3O5/c1-57-44-24-22-43(23-25-44)54-31-29-53(30-32-54)42-20-16-40(17-21-42)51(39-11-7-4-8-12-39)28-27-46-47(50(56)58-2)34-38-33-37(15-26-45(38)48(46)59-51)49(55)52-41-18-13-36(14-19-41)35-9-5-3-6-10-35/h3-28,33-34H,29-32H2,1-2H3,(H,52,55) |
| InChIKey | DEPBZQIRYGENSU-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.92 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|