C35H36N2O4 — CID 21076405
methyl 9-(dimethylamino)-2-(4-methoxyphenyl)-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5-carboxylate (PubChem CID 21076405) has the molecular formula C35H36N2O4 and a molecular weight of 548.68 g/mol. Its IUPAC name is methyl 9-(dimethylamino)-2-(4-methoxyphenyl)-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5-carboxylate.
| Compound Name | methyl 9-(dimethylamino)-2-(4-methoxyphenyl)-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 21076405 |
| Molecular Formula | C35H36N2O4 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | methyl 9-(dimethylamino)-2-(4-methoxyphenyl)-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5-carboxylate |
| SMILES | COC(=O)c1cc2ccc(N(C)C)cc2c2c1C=CC(c1ccc(OC)cc1)(c1ccc(N3CCCCC3)cc1)O2 |
| InChI | InChI=1S/C35H36N2O4/c1-36(2)28-13-8-24-22-32(34(38)40-4)30-18-19-35(41-33(30)31(24)23-28,26-11-16-29(39-3)17-12-26)25-9-14-27(15-10-25)37-20-6-5-7-21-37/h8-19,22-23H,5-7,20-21H2,1-4H3 |
| InChIKey | SZXQOOGBKAEUIO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|