C44H59N3O6Si2 — CID 58912273
2-[2-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]acetyl]oxyethyl 9-(dimethylamino)-2,2-bis[4-(dimethylamino)phenyl]benzo[h]chromene-5-carboxylate (PubChem CID 58912273) has the molecular formula C44H59N3O6Si2 and a molecular weight of 782.14 g/mol. Its IUPAC name is 2-[2-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]acetyl]oxyethyl 9-(dimethylamino)-2,2-bis[4-(dimethylamino)phenyl]benzo[h]chromene-5-carboxylate.
| Compound Name | 2-[2-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]acetyl]oxyethyl 9-(dimethylamino)-2,2-bis[4-(dimethylamino)phenyl]benzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 58912273 |
| Molecular Formula | C44H59N3O6Si2 |
| Molecular Weight | 782.14 g/mol |
| Exact Mass | 781.39 |
| IUPAC Name | 2-[2-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]acetyl]oxyethyl 9-(dimethylamino)-2,2-bis[4-(dimethylamino)phenyl]benzo[h]chromene-5-carboxylate |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)CC(=O)OCCOC(=O)c1cc2ccc(N(C)C)cc2c2c1C=CC(c1ccc(N(C)C)cc1)(c1ccc(N(C)C)cc1)O2 |
| InChI | InChI=1S/C44H59N3O6Si2/c1-12-13-28-54(8,9)53-55(10,11)31-41(48)50-26-27-51-43(49)40-29-32-14-19-37(47(6)7)30-39(32)42-38(40)24-25-44(52-42,33-15-20-35(21-16-33)45(2)3)34-17-22-36(23-18-34)46(4)5/h14-25,29-30H,12-13,26-28,31H2,1-11H3 |
| InChIKey | OYJUDCWXFPLREN-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.14 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|