C48H47NO3 — CID 58274171
methyl 2-[4-(diethylamino)phenyl]-6-[4-(4-pentylphenyl)phenyl]-2-phenylbenzo[h]chromene-5-carboxylate (PubChem CID 58274171) has the molecular formula C48H47NO3 and a molecular weight of 685.91 g/mol. Its IUPAC name is methyl 2-[4-(diethylamino)phenyl]-6-[4-(4-pentylphenyl)phenyl]-2-phenylbenzo[h]chromene-5-carboxylate.
| Compound Name | methyl 2-[4-(diethylamino)phenyl]-6-[4-(4-pentylphenyl)phenyl]-2-phenylbenzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 58274171 |
| Molecular Formula | C48H47NO3 |
| Molecular Weight | 685.91 g/mol |
| Exact Mass | 685.36 |
| IUPAC Name | methyl 2-[4-(diethylamino)phenyl]-6-[4-(4-pentylphenyl)phenyl]-2-phenylbenzo[h]chromene-5-carboxylate |
| SMILES | CCCCCc1ccc(-c2ccc(-c3c(C(=O)OC)c4c(c5ccccc35)OC(c3ccccc3)(c3ccc(N(CC)CC)cc3)C=C4)cc2)cc1 |
| InChI | InChI=1S/C48H47NO3/c1-5-8-10-15-34-20-22-35(23-21-34)36-24-26-37(27-25-36)44-41-18-13-14-19-42(41)46-43(45(44)47(50)51-4)32-33-48(52-46,38-16-11-9-12-17-38)39-28-30-40(31-29-39)49(6-2)7-3/h9,11-14,16-33H,5-8,10,15H2,1-4H3 |
| InChIKey | JDDSKDVABHJRGF-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.91 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|