C38H44O6Si2 — CID 158941285
methyl 6-[2-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]acetyl]oxy-2-(4-methylphenyl)-2-phenylbenzo[h]chromene-5-carboxylate (PubChem CID 158941285) has the molecular formula C38H44O6Si2 and a molecular weight of 652.94 g/mol. Its IUPAC name is methyl 6-[2-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]acetyl]oxy-2-(4-methylphenyl)-2-phenylbenzo[h]chromene-5-carboxylate.
| Compound Name | methyl 6-[2-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]acetyl]oxy-2-(4-methylphenyl)-2-phenylbenzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 158941285 |
| Molecular Formula | C38H44O6Si2 |
| Molecular Weight | 652.94 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | methyl 6-[2-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]acetyl]oxy-2-(4-methylphenyl)-2-phenylbenzo[h]chromene-5-carboxylate |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)CC(=O)Oc1c(C(=O)OC)c2c(c3ccccc13)OC(c1ccccc1)(c1ccc(C)cc1)C=C2 |
| InChI | InChI=1S/C38H44O6Si2/c1-8-9-25-45(4,5)44-46(6,7)26-33(39)42-36-31-18-14-13-17-30(31)35-32(34(36)37(40)41-3)23-24-38(43-35,28-15-11-10-12-16-28)29-21-19-27(2)20-22-29/h10-24H,8-9,25-26H2,1-7H3 |
| InChIKey | IYULJDWRIYRHED-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.94 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|