C34H26O3 — CID 18316931
ethyl 2,2,5-triphenylbenzo[h]chromene-6-carboxylate (PubChem CID 18316931) has the molecular formula C34H26O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is ethyl 2,2,5-triphenylbenzo[h]chromene-6-carboxylate.
| Compound Name | ethyl 2,2,5-triphenylbenzo[h]chromene-6-carboxylate |
|---|---|
| PubChem CID | 18316931 |
| Molecular Formula | C34H26O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | ethyl 2,2,5-triphenylbenzo[h]chromene-6-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c2c(c3ccccc13)OC(c1ccccc1)(c1ccccc1)C=C2 |
| InChI | InChI=1S/C34H26O3/c1-2-36-33(35)31-27-20-12-13-21-28(27)32-29(30(31)24-14-6-3-7-15-24)22-23-34(37-32,25-16-8-4-9-17-25)26-18-10-5-11-19-26/h3-23H,2H2,1H3 |
| InChIKey | MSFZFJSOPDDUDL-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |