C39H34O5 — CID 145126589
ethyl 6-(2-oxoethyl)-2-(4-phenylphenyl)-2-(4-propoxyphenyl)benzo[h]chromene-5-carboxylate (PubChem CID 145126589) has the molecular formula C39H34O5 and a molecular weight of 582.70 g/mol. Its IUPAC name is ethyl 6-(2-oxoethyl)-2-(4-phenylphenyl)-2-(4-propoxyphenyl)benzo[h]chromene-5-carboxylate.
| Compound Name | ethyl 6-(2-oxoethyl)-2-(4-phenylphenyl)-2-(4-propoxyphenyl)benzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 145126589 |
| Molecular Formula | C39H34O5 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | ethyl 6-(2-oxoethyl)-2-(4-phenylphenyl)-2-(4-propoxyphenyl)benzo[h]chromene-5-carboxylate |
| SMILES | CCCOc1ccc(C2(c3ccc(-c4ccccc4)cc3)C=Cc3c(C(=O)OCC)c(CC=O)c4ccccc4c3O2)cc1 |
| InChI | InChI=1S/C39H34O5/c1-3-26-43-31-20-18-30(19-21-31)39(29-16-14-28(15-17-29)27-10-6-5-7-11-27)24-22-35-36(38(41)42-4-2)33(23-25-40)32-12-8-9-13-34(32)37(35)44-39/h5-22,24-25H,3-4,23,26H2,1-2H3 |
| InChIKey | UKCOXUNDFULDPH-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|