C37H38O9 — CID 166731002
methyl 2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-6-[2-(2-methylprop-2-enylperoxy)ethoxy]-2-phenylbenzo[h]chromene-5-carboxylate (PubChem CID 166731002) has the molecular formula C37H38O9 and a molecular weight of 626.70 g/mol. Its IUPAC name is methyl 2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-6-[2-(2-methylprop-2-enylperoxy)ethoxy]-2-phenylbenzo[h]chromene-5-carboxylate.
| Compound Name | methyl 2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-6-[2-(2-methylprop-2-enylperoxy)ethoxy]-2-phenylbenzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 166731002 |
| Molecular Formula | C37H38O9 |
| Molecular Weight | 626.70 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | methyl 2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-6-[2-(2-methylprop-2-enylperoxy)ethoxy]-2-phenylbenzo[h]chromene-5-carboxylate |
| SMILES | C=C(C)COOCCOc1c(C(=O)OC)c2c(c3ccccc13)OC(c1ccccc1)(c1ccc(OCCOCCO)cc1)C=C2 |
| InChI | InChI=1S/C37H38O9/c1-26(2)25-45-44-24-23-43-35-31-12-8-7-11-30(31)34-32(33(35)36(39)40-3)17-18-37(46-34,27-9-5-4-6-10-27)28-13-15-29(16-14-28)42-22-21-41-20-19-38/h4-18,38H,1,19-25H2,2-3H3 |
| InChIKey | GENRLOZAPUDVOA-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.70 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|