C35H36O8 — CID 156852937
methyl 2-[2-ethoxy-4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-9-methoxy-6-methyl-2-phenylbenzo[h]chromene-5-carboxylate (PubChem CID 156852937) has the molecular formula C35H36O8 and a molecular weight of 584.66 g/mol. Its IUPAC name is methyl 2-[2-ethoxy-4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-9-methoxy-6-methyl-2-phenylbenzo[h]chromene-5-carboxylate.
| Compound Name | methyl 2-[2-ethoxy-4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-9-methoxy-6-methyl-2-phenylbenzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 156852937 |
| Molecular Formula | C35H36O8 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | methyl 2-[2-ethoxy-4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-9-methoxy-6-methyl-2-phenylbenzo[h]chromene-5-carboxylate |
| SMILES | CCOc1cc(OCCOCCO)ccc1C1(c2ccccc2)C=Cc2c(C(=O)OC)c(C)c3ccc(OC)cc3c2O1 |
| InChI | InChI=1S/C35H36O8/c1-5-41-31-22-26(42-20-19-40-18-17-36)12-14-30(31)35(24-9-7-6-8-10-24)16-15-28-32(34(37)39-4)23(2)27-13-11-25(38-3)21-29(27)33(28)43-35/h6-16,21-22,36H,5,17-20H2,1-4H3 |
| InChIKey | HBMWHNZAZBNDKW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|