C48H44O6 — CID 178181950
3,10-bis(4-methoxy-2-propoxyphenyl)-3,10-diphenylchromeno[5,6-f]chromene (PubChem CID 178181950) has the molecular formula C48H44O6 and a molecular weight of 716.87 g/mol. Its IUPAC name is 3,10-bis(4-methoxy-2-propoxyphenyl)-3,10-diphenylchromeno[5,6-f]chromene.
| Compound Name | 3,10-bis(4-methoxy-2-propoxyphenyl)-3,10-diphenylchromeno[5,6-f]chromene |
|---|---|
| PubChem CID | 178181950 |
| Molecular Formula | C48H44O6 |
| Molecular Weight | 716.87 g/mol |
| Exact Mass | 716.31 |
| IUPAC Name | 3,10-bis(4-methoxy-2-propoxyphenyl)-3,10-diphenylchromeno[5,6-f]chromene |
| SMILES | CCCOc1cc(OC)ccc1C1(c2ccccc2)C=Cc2c(ccc3ccc4c(c23)C=CC(c2ccccc2)(c2ccc(OC)cc2OCCC)O4)O1 |
| InChI | InChI=1S/C48H44O6/c1-5-29-51-44-31-36(49-3)19-21-40(44)47(34-13-9-7-10-14-34)27-25-38-42(53-47)23-17-33-18-24-43-39(46(33)38)26-28-48(54-43,35-15-11-8-12-16-35)41-22-20-37(50-4)32-45(41)52-30-6-2/h7-28,31-32H,5-6,29-30H2,1-4H3 |
| InChIKey | LGNPLVKQZFGYPT-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.87 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |