About 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene]
7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene] (PubChem CID 19084318) has the molecular formula C29H22O3
and a molecular weight of 418.49 g/mol. Its IUPAC name is 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene].
Molecular Properties
| Compound Name | 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene] |
| PubChem CID | 19084318 |
| Molecular Formula | C29H22O3 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene] |
| SMILES | COc1ccc2c(c1)OC(c1ccccc1)=C(C)C21C=Cc2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C29H22O3/c1-19-28(21-9-4-3-5-10-21)31-27-18-22(30-2)13-14-25(27)29(19)17-16-24-23-11-7-6-8-20(23)12-15-26(24)32-29/h3-18H,1-2H3 |
| InChIKey | WVRXADCSKPBCFC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene]?
The IUPAC name of 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene] (CID 19084318) is 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene].
What is the SMILES notation for 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene]?
The canonical SMILES for 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene] is COc1ccc2c(c1)OC(c1ccccc1)=C(C)C21C=Cc2c(ccc3ccccc23)O1.
What is the InChIKey of 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene]?
The InChIKey is WVRXADCSKPBCFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22O3/c1-19-28(21-9-4-3-5-10-21)31-27-18-22(30-2)13-14-25(27)29(19)17-16-24-23-11-7-6-8-20(23)12-15-26(24)32-29/h3-18H,1-2H3.
What are the key properties of 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene]?
7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene] has a molecular weight of 418.49 g/mol, XLogP of 6.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7'-methoxy-3'-methyl-2'-phenylspiro[benzo[f]chromene-3,4'-chromene] is sourced from PubChem (CID 19084318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).