C50H48O6 — CID 178181948
3,10-bis(4-butoxy-2-methoxyphenyl)-3,10-diphenylchromeno[5,6-f]chromene (PubChem CID 178181948) has the molecular formula C50H48O6 and a molecular weight of 744.93 g/mol. Its IUPAC name is 3,10-bis(4-butoxy-2-methoxyphenyl)-3,10-diphenylchromeno[5,6-f]chromene.
| Compound Name | 3,10-bis(4-butoxy-2-methoxyphenyl)-3,10-diphenylchromeno[5,6-f]chromene |
|---|---|
| PubChem CID | 178181948 |
| Molecular Formula | C50H48O6 |
| Molecular Weight | 744.93 g/mol |
| Exact Mass | 744.35 |
| IUPAC Name | 3,10-bis(4-butoxy-2-methoxyphenyl)-3,10-diphenylchromeno[5,6-f]chromene |
| SMILES | CCCCOc1ccc(C2(c3ccccc3)C=Cc3c(ccc4ccc5c(c34)C=CC(c3ccccc3)(c3ccc(OCCCC)cc3OC)O5)O2)c(OC)c1 |
| InChI | InChI=1S/C50H48O6/c1-5-7-31-53-38-21-23-42(46(33-38)51-3)49(36-15-11-9-12-16-36)29-27-40-44(55-49)25-19-35-20-26-45-41(48(35)40)28-30-50(56-45,37-17-13-10-14-18-37)43-24-22-39(34-47(43)52-4)54-32-8-6-2/h9-30,33-34H,5-8,31-32H2,1-4H3 |
| InChIKey | DCLIKYQLZZVOPK-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.93 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|