C40H38O7 — CID 58596282
2-[2-[[10,18-dimethoxy-5-(4-methoxyphenyl)-21-methyl-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-21-yl]oxy]ethoxy]ethanol (PubChem CID 58596282) has the molecular formula C40H38O7 and a molecular weight of 630.74 g/mol. Its IUPAC name is 2-[2-[[10,18-dimethoxy-5-(4-methoxyphenyl)-21-methyl-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-21-yl]oxy]ethoxy]ethanol.
| Compound Name | 2-[2-[[10,18-dimethoxy-5-(4-methoxyphenyl)-21-methyl-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-21-yl]oxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 58596282 |
| Molecular Formula | C40H38O7 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.26 |
| IUPAC Name | 2-[2-[[10,18-dimethoxy-5-(4-methoxyphenyl)-21-methyl-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-21-yl]oxy]ethoxy]ethanol |
| SMILES | COc1ccc(C2(c3ccccc3)C=Cc3c4c(c5ccc(OC)cc5c3O2)-c2ccc(OC)cc2C4(C)OCCOCCO)cc1 |
| InChI | InChI=1S/C40H38O7/c1-39(46-23-22-45-21-20-41)35-25-30(44-4)15-17-32(35)36-31-16-14-29(43-3)24-34(31)38-33(37(36)39)18-19-40(47-38,26-8-6-5-7-9-26)27-10-12-28(42-2)13-11-27/h5-19,24-25,41H,20-23H2,1-4H3 |
| InChIKey | XEMAXSQTECVMBE-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|