C38H31ClO6 — CID 89282920
2-[[5,5-bis(4-methoxyphenyl)-21-methyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaen-21-yl]oxy]ethyl carbonochloridate (PubChem CID 89282920) has the molecular formula C38H31ClO6 and a molecular weight of 619.11 g/mol. Its IUPAC name is 2-[[5,5-bis(4-methoxyphenyl)-21-methyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaen-21-yl]oxy]ethyl carbonochloridate.
| Compound Name | 2-[[5,5-bis(4-methoxyphenyl)-21-methyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaen-21-yl]oxy]ethyl carbonochloridate |
|---|---|
| PubChem CID | 89282920 |
| Molecular Formula | C38H31ClO6 |
| Molecular Weight | 619.11 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | 2-[[5,5-bis(4-methoxyphenyl)-21-methyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaen-21-yl]oxy]ethyl carbonochloridate |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)C=Cc3c4c(c5ccccc5c3O2)-c2ccccc2C4(C)OCCOC(=O)Cl)cc1 |
| InChI | InChI=1S/C38H31ClO6/c1-37(44-23-22-43-36(39)40)32-11-7-6-10-30(32)33-28-8-4-5-9-29(28)35-31(34(33)37)20-21-38(45-35,24-12-16-26(41-2)17-13-24)25-14-18-27(42-3)19-15-25/h4-21H,22-23H2,1-3H3 |
| InChIKey | FTKUIYCYGWXRCT-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.11 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|