C44H46O7 — CID 71045920
21-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5,5-bis(4-methoxyphenyl)-10,18,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaene (PubChem CID 71045920) has the molecular formula C44H46O7 and a molecular weight of 686.84 g/mol. Its IUPAC name is 21-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5,5-bis(4-methoxyphenyl)-10,18,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaene.
| Compound Name | 21-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5,5-bis(4-methoxyphenyl)-10,18,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 71045920 |
| Molecular Formula | C44H46O7 |
| Molecular Weight | 686.84 g/mol |
| Exact Mass | 686.32 |
| IUPAC Name | 21-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-5,5-bis(4-methoxyphenyl)-10,18,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaene |
| SMILES | COCCOCCOCCOC1(C)c2cc(C)ccc2-c2c1c1c(c3cc(C)ccc23)OC(c2ccc(OC)cc2)(c2ccc(OC)cc2)C=C1 |
| InChI | InChI=1S/C44H46O7/c1-29-7-17-35-38(27-29)42-37(19-20-44(51-42,31-9-13-33(46-5)14-10-31)32-11-15-34(47-6)16-12-32)41-40(35)36-18-8-30(2)28-39(36)43(41,3)50-26-25-49-24-23-48-22-21-45-4/h7-20,27-28H,21-26H2,1-6H3 |
| InChIKey | SGQPSDHNUNLZIY-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.84 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|