C32H26O6 — CID 102424347
methyl 2-(4-methoxyphenyl)-6-(2-methylprop-2-enoyloxy)-2-phenylbenzo[h]chromene-5-carboxylate (PubChem CID 102424347) has the molecular formula C32H26O6 and a molecular weight of 506.55 g/mol. Its IUPAC name is methyl 2-(4-methoxyphenyl)-6-(2-methylprop-2-enoyloxy)-2-phenylbenzo[h]chromene-5-carboxylate.
| Compound Name | methyl 2-(4-methoxyphenyl)-6-(2-methylprop-2-enoyloxy)-2-phenylbenzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 102424347 |
| Molecular Formula | C32H26O6 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | methyl 2-(4-methoxyphenyl)-6-(2-methylprop-2-enoyloxy)-2-phenylbenzo[h]chromene-5-carboxylate |
| SMILES | C=C(C)C(=O)Oc1c(C(=O)OC)c2c(c3ccccc13)OC(c1ccccc1)(c1ccc(OC)cc1)C=C2 |
| InChI | InChI=1S/C32H26O6/c1-20(2)30(33)37-29-25-13-9-8-12-24(25)28-26(27(29)31(34)36-4)18-19-32(38-28,21-10-6-5-7-11-21)22-14-16-23(35-3)17-15-22/h5-19H,1H2,2-4H3 |
| InChIKey | MGHWULSRQSQFSS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|