C31H20F6O5 — CID 23371125
methyl 6-acetyloxy-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate (PubChem CID 23371125) has the molecular formula C31H20F6O5 and a molecular weight of 586.48 g/mol. Its IUPAC name is methyl 6-acetyloxy-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate.
| Compound Name | methyl 6-acetyloxy-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 23371125 |
| Molecular Formula | C31H20F6O5 |
| Molecular Weight | 586.48 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | methyl 6-acetyloxy-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate |
| SMILES | COC(=O)c1c2c(c3ccccc3c1OC(C)=O)OC(c1cccc(C(F)(F)F)c1)(c1cccc(C(F)(F)F)c1)C=C2 |
| InChI | InChI=1S/C31H20F6O5/c1-17(38)41-27-23-12-4-3-11-22(23)26-24(25(27)28(39)40-2)13-14-29(42-26,18-7-5-9-20(15-18)30(32,33)34)19-8-6-10-21(16-19)31(35,36)37/h3-16H,1-2H3 |
| InChIKey | MBPWGCXOPMRZII-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.48 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|