C35H31N3O3 — CID 70806198
[4-[4-(4-methoxyphenyl)-3-oxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2(7),5,8,10,12,15,17,19-nonaen-4-yl]phenoxy]methanetriamine (PubChem CID 70806198) has the molecular formula C35H31N3O3 and a molecular weight of 541.65 g/mol. Its IUPAC name is [4-[4-(4-methoxyphenyl)-3-oxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2(7),5,8,10,12,15,17,19-nonaen-4-yl]phenoxy]methanetriamine.
| Compound Name | [4-[4-(4-methoxyphenyl)-3-oxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2(7),5,8,10,12,15,17,19-nonaen-4-yl]phenoxy]methanetriamine |
|---|---|
| PubChem CID | 70806198 |
| Molecular Formula | C35H31N3O3 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | [4-[4-(4-methoxyphenyl)-3-oxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2(7),5,8,10,12,15,17,19-nonaen-4-yl]phenoxy]methanetriamine |
| SMILES | COc1ccc(C2(c3ccc(OC(N)(N)N)cc3)C=Cc3c(c4c(c5ccccc35)-c3ccccc3CC4)O2)cc1 |
| InChI | InChI=1S/C35H31N3O3/c1-39-25-15-11-23(12-16-25)34(24-13-17-26(18-14-24)40-35(36,37)38)21-20-30-28-8-4-5-9-29(28)32-27-7-3-2-6-22(27)10-19-31(32)33(30)41-34/h2-9,11-18,20-21H,10,19,36-38H2,1H3 |
| InChIKey | NCJNJLWLWFNMDW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|