C30H24O4 — CID 102311410
2-(3,3-diphenylbenzo[f]chromen-8-yl)oxyethyl prop-2-enoate (PubChem CID 102311410) has the molecular formula C30H24O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-(3,3-diphenylbenzo[f]chromen-8-yl)oxyethyl prop-2-enoate.
| Compound Name | 2-(3,3-diphenylbenzo[f]chromen-8-yl)oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 102311410 |
| Molecular Formula | C30H24O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-(3,3-diphenylbenzo[f]chromen-8-yl)oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc2c3c(ccc2c1)OC(c1ccccc1)(c1ccccc1)C=C3 |
| InChI | InChI=1S/C30H24O4/c1-2-29(31)33-20-19-32-25-14-15-26-22(21-25)13-16-28-27(26)17-18-30(34-28,23-9-5-3-6-10-23)24-11-7-4-8-12-24/h2-18,21H,1,19-20H2 |
| InChIKey | CUZCNVANAXSDBU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|