C33H34O3 — CID 143257832
ethane;[3-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]-3-phenylbenzo[f]chromen-8-yl]methyl prop-2-enoate (PubChem CID 143257832) has the molecular formula C33H34O3 and a molecular weight of 478.63 g/mol. Its IUPAC name is ethane;[3-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]-3-phenylbenzo[f]chromen-8-yl]methyl prop-2-enoate.
| Compound Name | ethane;[3-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]-3-phenylbenzo[f]chromen-8-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 143257832 |
| Molecular Formula | C33H34O3 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | ethane;[3-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]-3-phenylbenzo[f]chromen-8-yl]methyl prop-2-enoate |
| SMILES | C=C/C=C(C)\C(=C/C)C1(c2ccccc2)C=Cc2c(ccc3cc(COC(=O)C=C)ccc23)O1.CC |
| InChI | InChI=1S/C31H28O3.C2H6/c1-5-11-22(4)28(6-2)31(25-12-9-8-10-13-25)19-18-27-26-16-14-23(21-33-30(32)7-3)20-24(26)15-17-29(27)34-31;1-2/h5-20H,1,3,21H2,2,4H3;1-2H3/b22-11-,28-6+; |
| InChIKey | PKBAOQPMFSKPID-IMBZWOSVSA-N |
| XLogP | 8.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|