C18H14O2 — CID 163424587
anthracen-2-ylmethyl prop-2-enoate (PubChem CID 163424587) has the molecular formula C18H14O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is anthracen-2-ylmethyl prop-2-enoate.
| Compound Name | anthracen-2-ylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 163424587 |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | anthracen-2-ylmethyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C18H14O2/c1-2-18(19)20-12-13-7-8-16-10-14-5-3-4-6-15(14)11-17(16)9-13/h2-11H,1,12H2 |
| InChIKey | ALJCFCUOCJYSIW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|