C12H10O3 — CID 174509033
2-benzofuran-5-ylmethyl prop-2-enoate (PubChem CID 174509033) has the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-benzofuran-5-ylmethyl prop-2-enoate.
| Compound Name | 2-benzofuran-5-ylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 174509033 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-benzofuran-5-ylmethyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc2cocc2c1 |
| InChI | InChI=1S/C12H10O3/c1-2-12(13)15-6-9-3-4-10-7-14-8-11(10)5-9/h2-5,7-8H,1,6H2 |
| InChIKey | PAACCKCSULBCRX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|