C26H15F3O4S — CID 101359754
spiro[benzo[f]chromene-3,9'-fluorene]-8-yl trifluoromethanesulfonate (PubChem CID 101359754) has the molecular formula C26H15F3O4S and a molecular weight of 480.46 g/mol. Its IUPAC name is spiro[benzo[f]chromene-3,9'-fluorene]-8-yl trifluoromethanesulfonate.
| Compound Name | spiro[benzo[f]chromene-3,9'-fluorene]-8-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101359754 |
| Molecular Formula | C26H15F3O4S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | spiro[benzo[f]chromene-3,9'-fluorene]-8-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c3c(ccc2c1)OC1(C=C3)c2ccccc2-c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C26H15F3O4S/c27-26(28,29)34(30,31)33-17-10-11-18-16(15-17)9-12-24-21(18)13-14-25(32-24)22-7-3-1-5-19(22)20-6-2-4-8-23(20)25/h1-15H |
| InChIKey | PSWSEKVPYIEAJN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|