C26H17F3O4S — CID 10983702
(3,3-diphenylbenzo[f]chromen-5-yl) trifluoromethanesulfonate (PubChem CID 10983702) has the molecular formula C26H17F3O4S and a molecular weight of 482.48 g/mol. Its IUPAC name is (3,3-diphenylbenzo[f]chromen-5-yl) trifluoromethanesulfonate.
| Compound Name | (3,3-diphenylbenzo[f]chromen-5-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10983702 |
| Molecular Formula | C26H17F3O4S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | (3,3-diphenylbenzo[f]chromen-5-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2ccccc2c2c1OC(c1ccccc1)(c1ccccc1)C=C2)C(F)(F)F |
| InChI | InChI=1S/C26H17F3O4S/c27-26(28,29)34(30,31)33-23-17-18-9-7-8-14-21(18)22-15-16-25(32-24(22)23,19-10-3-1-4-11-19)20-12-5-2-6-13-20/h1-17H |
| InChIKey | BSXPFZIZFZMZLY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|