C25H15F3O3S — CID 132538036
(1-phenanthren-9-ylnaphthalen-2-yl) trifluoromethanesulfonate (PubChem CID 132538036) has the molecular formula C25H15F3O3S and a molecular weight of 452.45 g/mol. Its IUPAC name is (1-phenanthren-9-ylnaphthalen-2-yl) trifluoromethanesulfonate.
| Compound Name | (1-phenanthren-9-ylnaphthalen-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 132538036 |
| Molecular Formula | C25H15F3O3S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | (1-phenanthren-9-ylnaphthalen-2-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2ccccc2c1-c1cc2ccccc2c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C25H15F3O3S/c26-25(27,28)32(29,30)31-23-14-13-16-7-1-4-10-19(16)24(23)22-15-17-8-2-3-9-18(17)20-11-5-6-12-21(20)22/h1-15H |
| InChIKey | QGGBOZOABIZJDW-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|