C20H17F3O3S — CID 23243239
[3,5-dimethyl-2-(2-methylnaphthalen-1-yl)phenyl] trifluoromethanesulfonate (PubChem CID 23243239) has the molecular formula C20H17F3O3S and a molecular weight of 394.41 g/mol. Its IUPAC name is [3,5-dimethyl-2-(2-methylnaphthalen-1-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dimethyl-2-(2-methylnaphthalen-1-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23243239 |
| Molecular Formula | C20H17F3O3S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | [3,5-dimethyl-2-(2-methylnaphthalen-1-yl)phenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c(-c2c(C)ccc3ccccc23)c(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F3O3S/c1-12-10-14(3)19(17(11-12)26-27(24,25)20(21,22)23)18-13(2)8-9-15-6-4-5-7-16(15)18/h4-11H,1-3H3 |
| InChIKey | JMELNGLMLDQDNF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|