C24H12F10O6S2 — CID 11215928
[1-[2-(1,1,2,2,2-pentafluoroethylsulfonyloxy)naphthalen-1-yl]naphthalen-2-yl] 1,1,2,2,2-pentafluoroethanesulfonate (PubChem CID 11215928) has the molecular formula C24H12F10O6S2 and a molecular weight of 650.47 g/mol. Its IUPAC name is [1-[2-(1,1,2,2,2-pentafluoroethylsulfonyloxy)naphthalen-1-yl]naphthalen-2-yl] 1,1,2,2,2-pentafluoroethanesulfonate.
| Compound Name | [1-[2-(1,1,2,2,2-pentafluoroethylsulfonyloxy)naphthalen-1-yl]naphthalen-2-yl] 1,1,2,2,2-pentafluoroethanesulfonate |
|---|---|
| PubChem CID | 11215928 |
| Molecular Formula | C24H12F10O6S2 |
| Molecular Weight | 650.47 g/mol |
| Exact Mass | 649.99 |
| IUPAC Name | [1-[2-(1,1,2,2,2-pentafluoroethylsulfonyloxy)naphthalen-1-yl]naphthalen-2-yl] 1,1,2,2,2-pentafluoroethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2ccccc2c1-c1c(OS(=O)(=O)C(F)(F)C(F)(F)F)ccc2ccccc12)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H12F10O6S2/c25-21(26,27)23(31,32)41(35,36)39-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)40-42(37,38)24(33,34)22(28,29)30/h1-12H |
| InChIKey | WKMLVOVWGYXFLU-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.47 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|