C16H15F3O5S — CID 175934620
[1-(trifluoromethylsulfonyloxy)naphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 175934620) has the molecular formula C16H15F3O5S and a molecular weight of 376.35 g/mol. Its IUPAC name is [1-(trifluoromethylsulfonyloxy)naphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [1-(trifluoromethylsulfonyloxy)naphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175934620 |
| Molecular Formula | C16H15F3O5S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | [1-(trifluoromethylsulfonyloxy)naphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2ccccc2c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H15F3O5S/c1-15(2,3)14(20)23-12-9-8-10-6-4-5-7-11(10)13(12)24-25(21,22)16(17,18)19/h4-9H,1-3H3 |
| InChIKey | WOJFTGBDTWUPEA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|