C20H13F3O3S — CID 101000252
(4-methylbenzo[c]phenanthren-1-yl) trifluoromethanesulfonate (PubChem CID 101000252) has the molecular formula C20H13F3O3S and a molecular weight of 390.38 g/mol. Its IUPAC name is (4-methylbenzo[c]phenanthren-1-yl) trifluoromethanesulfonate.
| Compound Name | (4-methylbenzo[c]phenanthren-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101000252 |
| Molecular Formula | C20H13F3O3S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | (4-methylbenzo[c]phenanthren-1-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)C(F)(F)F)c2c1ccc1ccc3ccccc3c12 |
| InChI | InChI=1S/C20H13F3O3S/c1-12-6-11-17(26-27(24,25)20(21,22)23)19-15(12)10-9-14-8-7-13-4-2-3-5-16(13)18(14)19/h2-11H,1H3 |
| InChIKey | WANRWKFQGUUUSQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|