C13H11F3O3S — CID 135045416
(2,5-dimethylnaphthalen-1-yl) trifluoromethanesulfonate (PubChem CID 135045416) has the molecular formula C13H11F3O3S and a molecular weight of 304.29 g/mol. Its IUPAC name is (2,5-dimethylnaphthalen-1-yl) trifluoromethanesulfonate.
| Compound Name | (2,5-dimethylnaphthalen-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135045416 |
| Molecular Formula | C13H11F3O3S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (2,5-dimethylnaphthalen-1-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2c(C)cccc2c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H11F3O3S/c1-8-4-3-5-11-10(8)7-6-9(2)12(11)19-20(17,18)13(14,15)16/h3-7H,1-2H3 |
| InChIKey | OSMZXEPFLXLDMW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|