C15H21F3O3S — CID 87391356
(2,6-ditert-butylphenyl) trifluoromethanesulfonate (PubChem CID 87391356) has the molecular formula C15H21F3O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is (2,6-ditert-butylphenyl) trifluoromethanesulfonate.
| Compound Name | (2,6-ditert-butylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87391356 |
| Molecular Formula | C15H21F3O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (2,6-ditert-butylphenyl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H21F3O3S/c1-13(2,3)10-8-7-9-11(14(4,5)6)12(10)21-22(19,20)15(16,17)18/h7-9H,1-6H3 |
| InChIKey | MMGBYKUVAKLVLM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|