C27H14F10O6S2 — CID 22572340
[4-[[3,5-difluoro-4-(trifluoromethylsulfonyloxy)phenyl]-diphenylmethyl]-2,6-difluorophenyl] trifluoromethanesulfonate (PubChem CID 22572340) has the molecular formula C27H14F10O6S2 and a molecular weight of 688.52 g/mol. Its IUPAC name is [4-[[3,5-difluoro-4-(trifluoromethylsulfonyloxy)phenyl]-diphenylmethyl]-2,6-difluorophenyl] trifluoromethanesulfonate.
| Compound Name | [4-[[3,5-difluoro-4-(trifluoromethylsulfonyloxy)phenyl]-diphenylmethyl]-2,6-difluorophenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22572340 |
| Molecular Formula | C27H14F10O6S2 |
| Molecular Weight | 688.52 g/mol |
| Exact Mass | 688.01 |
| IUPAC Name | [4-[[3,5-difluoro-4-(trifluoromethylsulfonyloxy)phenyl]-diphenylmethyl]-2,6-difluorophenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1c(F)cc(C(c2ccccc2)(c2ccccc2)c2cc(F)c(OS(=O)(=O)C(F)(F)F)c(F)c2)cc1F)C(F)(F)F |
| InChI | InChI=1S/C27H14F10O6S2/c28-19-11-17(12-20(29)23(19)42-44(38,39)26(32,33)34)25(15-7-3-1-4-8-15,16-9-5-2-6-10-16)18-13-21(30)24(22(31)14-18)43-45(40,41)27(35,36)37/h1-14H |
| InChIKey | QEGMXBIXYPYUQB-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.52 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|