C9H5F5O4S — CID 166482398
(2-acetyl-4,6-difluorophenyl) trifluoromethanesulfonate (PubChem CID 166482398) has the molecular formula C9H5F5O4S and a molecular weight of 304.19 g/mol. Its IUPAC name is (2-acetyl-4,6-difluorophenyl) trifluoromethanesulfonate.
| Compound Name | (2-acetyl-4,6-difluorophenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166482398 |
| Molecular Formula | C9H5F5O4S |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | (2-acetyl-4,6-difluorophenyl) trifluoromethanesulfonate |
| SMILES | CC(=O)c1cc(F)cc(F)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H5F5O4S/c1-4(15)6-2-5(10)3-7(11)8(6)18-19(16,17)9(12,13)14/h2-3H,1H3 |
| InChIKey | BQKPPCVBIWTYNO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|