C10H10F2O2 — CID 83880634
1-(2-ethoxy-3,5-difluorophenyl)ethanone (PubChem CID 83880634) has the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. Its IUPAC name is 1-(2-ethoxy-3,5-difluorophenyl)ethanone.
| Compound Name | 1-(2-ethoxy-3,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 83880634 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1-(2-ethoxy-3,5-difluorophenyl)ethanone |
| SMILES | CCOc1c(F)cc(F)cc1C(C)=O |
| InChI | InChI=1S/C10H10F2O2/c1-3-14-10-8(6(2)13)4-7(11)5-9(10)12/h4-5H,3H2,1-2H3 |
| InChIKey | VLDRLHSPHPOSPN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |