C10H13F2NO2 — CID 83887419
2-amino-2-(2-ethoxy-3,5-difluorophenyl)ethanol (PubChem CID 83887419) has the molecular formula C10H13F2NO2 and a molecular weight of 217.21 g/mol. Its IUPAC name is 2-amino-2-(2-ethoxy-3,5-difluorophenyl)ethanol.
| Compound Name | 2-amino-2-(2-ethoxy-3,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 83887419 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-amino-2-(2-ethoxy-3,5-difluorophenyl)ethanol |
| SMILES | CCOc1c(F)cc(F)cc1C(N)CO |
| InChI | InChI=1S/C10H13F2NO2/c1-2-15-10-7(9(13)5-14)3-6(11)4-8(10)12/h3-4,9,14H,2,5,13H2,1H3 |
| InChIKey | KEFVGALOXHNEOW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |