C12H16F2O2 — CID 91656918
1-(2-butoxy-3,5-difluorophenyl)ethanol (PubChem CID 91656918) has the molecular formula C12H16F2O2 and a molecular weight of 230.25 g/mol. Its IUPAC name is 1-(2-butoxy-3,5-difluorophenyl)ethanol.
| Compound Name | 1-(2-butoxy-3,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 91656918 |
| Molecular Formula | C12H16F2O2 |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-(2-butoxy-3,5-difluorophenyl)ethanol |
| SMILES | CCCCOc1c(F)cc(F)cc1C(C)O |
| InChI | InChI=1S/C12H16F2O2/c1-3-4-5-16-12-10(8(2)15)6-9(13)7-11(12)14/h6-8,15H,3-5H2,1-2H3 |
| InChIKey | HHHPQVXGFDKUNJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|