C12H13ClF2O2 — CID 91655224
3,5-difluoro-2-pentoxybenzoyl chloride (PubChem CID 91655224) has the molecular formula C12H13ClF2O2 and a molecular weight of 262.68 g/mol. Its IUPAC name is 3,5-difluoro-2-pentoxybenzoyl chloride.
| Compound Name | 3,5-difluoro-2-pentoxybenzoyl chloride |
|---|---|
| PubChem CID | 91655224 |
| Molecular Formula | C12H13ClF2O2 |
| Molecular Weight | 262.68 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3,5-difluoro-2-pentoxybenzoyl chloride |
| SMILES | CCCCCOc1c(F)cc(F)cc1C(=O)Cl |
| InChI | InChI=1S/C12H13ClF2O2/c1-2-3-4-5-17-11-9(12(13)16)6-8(14)7-10(11)15/h6-7H,2-5H2,1H3 |
| InChIKey | JQMNMTKCUIOEJU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|