About 2-butoxy-5-fluorobenzoyl chloride
2-butoxy-5-fluorobenzoyl chloride (PubChem CID 91656743) has the molecular formula C11H12ClFO2
and a molecular weight of 230.67 g/mol. Its IUPAC name is 2-butoxy-5-fluorobenzoyl chloride.
Molecular Properties
| Compound Name | 2-butoxy-5-fluorobenzoyl chloride |
| PubChem CID | 91656743 |
| Molecular Formula | C11H12ClFO2 |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-butoxy-5-fluorobenzoyl chloride |
| SMILES | CCCCOc1ccc(F)cc1C(=O)Cl |
| InChI | InChI=1S/C11H12ClFO2/c1-2-3-6-15-10-5-4-8(13)7-9(10)11(12)14/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | UMFOPRQQGTYHHU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-5-fluorobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-5-fluorobenzoyl chloride?
The IUPAC name of 2-butoxy-5-fluorobenzoyl chloride (CID 91656743) is 2-butoxy-5-fluorobenzoyl chloride.
What is the SMILES notation for 2-butoxy-5-fluorobenzoyl chloride?
The canonical SMILES for 2-butoxy-5-fluorobenzoyl chloride is CCCCOc1ccc(F)cc1C(=O)Cl.
What is the InChIKey of 2-butoxy-5-fluorobenzoyl chloride?
The InChIKey is UMFOPRQQGTYHHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClFO2/c1-2-3-6-15-10-5-4-8(13)7-9(10)11(12)14/h4-5,7H,2-3,6H2,1H3.
What are the key properties of 2-butoxy-5-fluorobenzoyl chloride?
2-butoxy-5-fluorobenzoyl chloride has a molecular weight of 230.67 g/mol, XLogP of 3.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-5-fluorobenzoyl chloride is sourced from PubChem (CID 91656743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).