C14H17BrFNO3 — CID 75520372
2-(2-acetyl-4-bromo-6-fluorophenoxy)-N,N-diethylacetamide (PubChem CID 75520372) has the molecular formula C14H17BrFNO3 and a molecular weight of 346.20 g/mol. Its IUPAC name is 2-(2-acetyl-4-bromo-6-fluorophenoxy)-N,N-diethylacetamide.
| Compound Name | 2-(2-acetyl-4-bromo-6-fluorophenoxy)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 75520372 |
| Molecular Formula | C14H17BrFNO3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-(2-acetyl-4-bromo-6-fluorophenoxy)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1c(F)cc(Br)cc1C(C)=O |
| InChI | InChI=1S/C14H17BrFNO3/c1-4-17(5-2)13(19)8-20-14-11(9(3)18)6-10(15)7-12(14)16/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | XNEYXFREYLILRM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |