C12H14Br2ClNO4S — CID 82913649
3,5-dibromo-4-[2-(diethylamino)-2-oxoethoxy]benzenesulfonyl chloride (PubChem CID 82913649) has the molecular formula C12H14Br2ClNO4S and a molecular weight of 463.58 g/mol. Its IUPAC name is 3,5-dibromo-4-[2-(diethylamino)-2-oxoethoxy]benzenesulfonyl chloride.
| Compound Name | 3,5-dibromo-4-[2-(diethylamino)-2-oxoethoxy]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82913649 |
| Molecular Formula | C12H14Br2ClNO4S |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 460.87 |
| IUPAC Name | 3,5-dibromo-4-[2-(diethylamino)-2-oxoethoxy]benzenesulfonyl chloride |
| SMILES | CCN(CC)C(=O)COc1c(Br)cc(S(=O)(=O)Cl)cc1Br |
| InChI | InChI=1S/C12H14Br2ClNO4S/c1-3-16(4-2)11(17)7-20-12-9(13)5-8(6-10(12)14)21(15,18)19/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | YPRUSZAZBRAICR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |