C9H7Br2ClO3S — CID 82909661
3,5-dibromo-4-prop-2-enoxybenzenesulfonyl chloride (PubChem CID 82909661) has the molecular formula C9H7Br2ClO3S and a molecular weight of 390.48 g/mol. Its IUPAC name is 3,5-dibromo-4-prop-2-enoxybenzenesulfonyl chloride.
| Compound Name | 3,5-dibromo-4-prop-2-enoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82909661 |
| Molecular Formula | C9H7Br2ClO3S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 387.82 |
| IUPAC Name | 3,5-dibromo-4-prop-2-enoxybenzenesulfonyl chloride |
| SMILES | C=CCOc1c(Br)cc(S(=O)(=O)Cl)cc1Br |
| InChI | InChI=1S/C9H7Br2ClO3S/c1-2-3-15-9-7(10)4-6(5-8(9)11)16(12,13)14/h2,4-5H,1,3H2 |
| InChIKey | MNIBYMIJOYJKKP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|