C11H7Br2ClN2O3S — CID 82910807
3,5-dibromo-4-(pyrimidin-2-ylmethoxy)benzenesulfonyl chloride (PubChem CID 82910807) has the molecular formula C11H7Br2ClN2O3S and a molecular weight of 442.52 g/mol. Its IUPAC name is 3,5-dibromo-4-(pyrimidin-2-ylmethoxy)benzenesulfonyl chloride.
| Compound Name | 3,5-dibromo-4-(pyrimidin-2-ylmethoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82910807 |
| Molecular Formula | C11H7Br2ClN2O3S |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 439.82 |
| IUPAC Name | 3,5-dibromo-4-(pyrimidin-2-ylmethoxy)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(Br)c(OCc2ncccn2)c(Br)c1 |
| InChI | InChI=1S/C11H7Br2ClN2O3S/c12-8-4-7(20(14,17)18)5-9(13)11(8)19-6-10-15-2-1-3-16-10/h1-5H,6H2 |
| InChIKey | PAOUXJSALGNGMK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |